Thozalinone

drugbox
IUPAC_name = 2-dimethylamino-5-phenyl-1,3-oxazol-4-one

---

CAS_number = 655-05-0
ATC_prefix =
ATC_suffix =
PubChem = 12602
smiles = C1=CC=CC=C1C2C(=O)N=C(O2)N(C)C
DrugBank =
C = 11 | H = 12 | N = 2 | O = 2
molecular_weight = 204.225 g/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Thozalinone is a centrally acting sympathomimetic which is related to other drugs such as pemoline and 4-methylaminorex. [Gielsdorf W. Determination of the psychostimulants pemoline, fenozolone and thozalinone in human urine by gas chromatography/mass spectrometry and thin layer chromatography. "Journal of Clinical Chemistry and Clinical Biochemistry". 1982 Feb;20(2):65-8.]

References