MEM (psychedelic)

Chembox new
ImageFile = MEM.png ImageSize =
IUPACName = 1-(4-ethoxy-2,5-dimethoxyphenyl)propan-2-amine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = CCOc1cc(OC)c(cc1OC)CC(C)N
Section2 = Chembox Properties
Formula = C₁₃H₂₁NO₃
MolarMass = 239.311 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MEM, or 2,5-dimethoxy-4-ethoxyamphetamine, is a lesser-known psychedelic drug. It is a dimethoxy-ethoxy analog of TMA-2. MEM was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 20-50mg, and the duration listed as 10-14 hours. MEM produces insights, and augments the effects of other drugs, like 2C-D. Shulgin gives it a +++ on the Shulgin Rating Scale. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEM.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal122.shtml MEM entry in "PiHKAL"]