DOEF

Chembox new
ImageFile1 = DOEF.png ImageSize1 = 200px
ImageFile2 =
ImageSize2 = 200px
IUPACName = 2- [4-(2-Fluoro-ethyl)-2,5-dimethoxy-phenyl] -1-methyl-ethylamine
OtherNames = 1- [4-(2-fluoroethyl)-2,5-dimethoxyphenyl] propan-2-amine
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1(=CC(=C(C=C1CC(C)N)OC)CCF)OC
Section2 = Chembox Properties
Formula = C₁₃H₂₀NO₂F
MolarMass = 241.305 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

DOEF, or 4-fluoroethyl-2,5-methoxyamphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. DOEF was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 2-3.5 [mg] , and the duration is listed as 12-16 hours. DOEF produces increased appreciation of music, closed-eye visuals, increased sexual pleasure, and intense slowing of time. Shulgin gives it a +++ on the Shulgin Rating Scale. Very little data exists about the pharmacological properties, metabolism, and toxicity of DOEF.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal065.shtml DOEF Entry in "PiHKAL"]