4-Bromo-3,5-dimethoxyamphetamine

Chembox new
ImageFile1 = 4-bromo-3,5-dimethoxyamphetamine.png ImageSize1 =
ImageFile2 = 4-bromo-3,5-dimethoxyamphetamine-3d-sticks.png ImageSize2 =
IUPACName = 2-(4-Bromo-3,5-dimethoxy-phenyl)-1-methyl-ethylamine
OtherNames = 4-Bromo-3,5-dimethoxyamphetamine
2-(4-Bromo-3,5-dimethoxyphenyl)ethan-1-methyl-amine
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1=C(C(=C(C=C1CC(C)N)OC)Br)OC
Section2 = Chembox Properties
Formula = C₁₁H₁₇NO₂Br
MolarMass = 274.154 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

4-Bromo-3,5-dimethoxyamphetamine is a lesser-known psychedelic drug and a substituted Amphetamine. It was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 4-10 mg, and the duration listed as 8-12 hours. It produces analgesia, numbness and reduction of physical feeling. Shulgin gives it a ++ on the Shulgin Rating Scale [CitePiHKAL] . Very little data exists about its pharmacological properties, metabolism, and toxicity.

References

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal018.shtml 4-bromo-3,5-dimethoxyamphetamine Entry in "PiHKAL"]