BOM (psychedelic)

Chembox new
ImageFile1 = 3,4,5,beta-tetramethoxyphenethylamine.png ImageSize1 =
ImageFile2 = BOM-3d-sticks.png ImageSize2 =
IUPACName = 2-Methoxy-2-(3,4,5-trimethoxy-phenyl)-ethylamine
OtherNames = 3,4,5,beta-Tetramethoxyphenethylamine
2-(3,4,5,beta-Tetramethoxyphenyl)ethanamine
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = COc1c(cc(cc1OC)C(CN)OC)OC
Section2 = Chembox Properties
Formula = C₁₂H₁₉NO₄
MolarMass = 241.28 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

BOM, or 3,4,5,beta-tetramethoxyphenethylamine, is a lesser-known psychedelic drug. It is the beta-methoxy analog of Mescaline. BOM was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 200 mg, and the duration unknown. BOM produces few to no effects. [CitePiHKAL] Very little data exists about its pharmacological properties, metabolism, and toxicity.

References

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal017.shtml BOM Entry in "PiHKAL"]