MDOH

Chembox new
ImageFile = MDOH.png ImageSize =
IUPACName = 1-(1,3-benzodioxol-5-yl)-N-hydroxypropan-2-amine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = CC(CC1=CC2=C(C=C1)OCO2)NO
Section2 = Chembox Properties
Formula = C₁₀H₁₃NO₃
MolarMass = 195.21512 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MDOH, or 3,4-methylenedioxy-N-hydroxyamphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. MDOH was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 100-160mg, and the duration is listed as approximately 3-6 hours. MDOH produces an increased pleasure in beauty and in nature, and is very psychedelic. It also produces several negative effects also seen in MDMA, such as difficulty urinating and internal dryness. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDOH.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal114.shtml MDOH entry in "PiHKAL"]