MDMEO

Chembox new
ImageFile = MDMEO.png ImageSize =
IUPACName = 1-(1,3-benzodioxol-5-yl)-N-methoxypropan-2-amine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1=C2C(=CC=C1CC(C)NOC)OCO2
Section2 = Chembox Properties
Formula = C₁₁H₁₅NO₃
MolarMass = 209.242 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MDMEO, or 3,4-methylenedioxy-"N"-methoxyamphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. It is also the N-methoxy analogue of MDA. MDMEO was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 180mg. MDMEO may be found as white crystals. It produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDMEO.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal111.shtml MDMEO entry in "PiHKAL"]