Farampator

drugbox
IUPAC_name = 2,1,3-benzoxadiazol-6-yl-piperidin-1-ylmethanone

---

width = 180
CAS_number = 211735-76-1
synonyms = Farampator, CX-691
ATC_prefix =
ATC_suffix =
PubChem = 4118151
DrugBank =
C = 12 | H = 13 | N = 3 | O = 2
molecular_weight = 231.25052 g/mol
smiles = C1CCN(CC1)C(=O)C2=CC3=NON=C3C=C2
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Investigational New Medicine
routes_of_administration =

Farampator (CX-691, ORG-24448) is an ampakine drug. It was developed by Cortex Pharmaceuticals, and licensed to Organon BioSciences for commercial development. Following the purchase of Organon by Schering-Plough in 2007, the development license to farampator has been transferred, and development is continuing.

Farampator has been investigated for its effect on AMPA receptors and researched for potential use in the treatment of schizophrenia and Alzheimer's Disease. It was found to improve short-term memory, but impaired episodic memory. It produced side effects (SEs) such as headache, somnolence and nausea. Subjects with SEs had significantly higher plasma levels of farampator than subjects without SEs. Additional analyses revealed that in the farampator condition the group without SEs showed a significantly superior memory performance relative to the group with SEs. [Wezenberg E, Verkes RJ, Ruigt GS, Hulstijn W, Sabbe BG. Acute effects of the ampakine farampator on memory and information processing in healthy elderly volunteers. "Neuropsychopharmacology". 2007 Jun;32(6):1272-83. [http://www.ncbi.nlm.nih.gov/sites/entrez/17119538 PMID 17119538] ]

References