- Lugduname
Chembox new
ImageFile = Lugduname.png
IUPACName = "N"-(4-Cyanophenyl)-"N"-(2,3-methylenedioxybenzyl)guanidinoacetic acid
OtherNames =
Section1 = Chembox Identifiers
CASNo = 180045-75-4
PubChem =
SMILES = OC(CN/C(NC3=CC=C(C#N)C=C3)=NCC1=CC=CC2=C1OCO2)=O
Section2 = Chembox Properties
C=18 |H=16 |N=4 |O=4
MolarMass = 352.34 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =Lugduname is the most potent sweetening agent known to man. Lugduname has been estimated to be between 220,000 and 300,000 times as sweet as
sucrose (table sugar), with estimates varying between studies. Lugduname is part of a family of extremely potent, guanidinocarboxylic acid, sweeteners with acetic acid functional groups onguanidine .External links
*
References
* Jiong Chen, Mookda Pattarawarapan, Alex J. Zhang, and Kevin Burgess. "Solution- and Solid-Phase Syntheses of Substituted Guanidinocarboxylic Acids". Journal of Combinatorial Chemistry. (2000) Vol. 2, No. 3 276(Contains a synthetic method for Lugduname, see Scheme 2)
* C. NOFRE, D. GLASER, J. -M. TINTI, and M. WANNER. " [http://www.blackwell-synergy.com/doi/pdf/10.1046/j.1439-0396.2002.00361.x Gustatory responses of pigs to sixty compounds tasting sweet to humans] " Journal of Animal Physiology and Animal Nutrition. 86 (2002), pp. 90-96
Wikimedia Foundation. 2010.