Acrivastine

drugbox
IUPAC_name = ("E")-3-{6- [("E")-1-(4-methylphenyl)-3-pyrrolidin-1-yl-
prop-1-enyl] pyridin-2-yl}prop-2-enoic acid

---

CAS_number = 87848-99-5
ATC_prefix = R06
ATC_suffix = AX18
PubChem = 5284514
DrugBank =
C = 22 | H = 24 | N = 2 | O = 2
molecular_weight = 348.438 g/mol
smiles = CC1=CC=C(C=C1)C(=CCN2CCCC2)C3=CC=CC(=N3)C=CC(=O)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life = 1.5 hours
excretion = Renal
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Acrivastine is a medication used for the treatment of allergies and hay fever. It is a second-generation H1-receptor antagonist antihistamine and works by blocking H1 histamine receptors.

It is sold under the brand name "Benadryl Allergy Relief" in the U.K. by Pfizer, not to be confused with "Benadryl Once a Day", which is cetirizine and is also sold by Pfizer in the U.K. This drug is currently not available as a generic in the U.K. [ [http://forums.moneysavingexpert.com/showthread.html?t=441494 Cheapest hayfever remedies 2007] , Money Saving expert, May 15th,2007]

In the U.S., "acrivastine" is the active ingredient in the "Semprex" brand. Semprex-D is also "acrivastine" based, but also contains a decongestant.

References