Bis-HPPP

Chembox new
Name = Bis-HPPP
ImageFile = Bis-HPPP.png ImageName =
IUPACName = 2,2-bis [4-(2,3-hydroxypropoxy)phenyl] propane
Section1 = Chembox Identifiers
CASNo =
SMILES = OCC(O)COc1ccc(cc1)C(C)(C)c2ccc(OCC(O)CO)cc2
Section2 = Chembox Properties
Formula = C₂₁H₂₈O₆
MolarMass = 376.44 g/mol
Density =
MeltingPt =
BoilingPt =

2,2-Bis [4(2,3-hydroxypropoxy)phenyl] propane (bis-HPPP) is an organic compound structurally related to Bisphenol A.

Together with methacrylic acid, bis-HPPP is released following the CE-catalyzed hydrolysis of 2,2- [4(2-hydroxy 3-methacryloxypropoxy)-phenyl] propane (bis-GMA). This reaction is very common in hydrolytic degradation of the dental resin since salivary esterases are able to cleave the ester bonds in acrylic polymers of dental composites.

Analysis by mass spectrometry demonstrated that hydrolytic reactions would cleave the ester bonds of both methacrylate units in bis-GMA and produce bis-HPPP along with two molecules of methacrylic acid. [cite journal | author = Finer Y, S.J. | title = The influence of resin chemistry on a dental composite's biodegradation | journal = J Biomed Mater Res | year = 2004 | volume = 69A | pages = 233–246 | doi = 10.1002/jbm.a.30000]

References