Isoproscaline

Chembox new
ImageFile1 = Isoproscaline.png ImageSize1 = 200px
ImageFile2 =
ImageSize2 = 200px
IUPACName = 2-(4-Isopropoxy-3,5-dimethoxy-phenyl)-ethylamine
OtherNames = 2-(4-Isopropoxy-3,5-dimethoxyphenyl)ethanamine
Section1 = Chembox Identifiers
CASNo = 64778-72-9
PubChem =
SMILES = CC(C)Oc1c(cc(cc1OC)CCN)OC
Section2 = Chembox Properties
Formula = C₁₃H₂₁NO₃
MolarMass = 239.31 g/mol
Appearance =
Density =
MeltingPt = 163-164 °C (hydrochloride)
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

Isoproscaline or 4-(i)-propyl-3,5-dimethoxyphenethylamine is an analogue of mescaline. It is closely related to proscaline and was first synthesized by David E. Nichols. It produces hallucinogenic, psychedelic, and entheogenic effects.

Chemistry

Isoproscaline is in a class of compounds commonly known as phenethylamines, and the full chemical name is 2-(4-isopropoxy-3,5-dimethoxyphenyl)ethanamine.

Effects

Little is known about the psychopharmacological effects of isoproscaline. Alexander Shulgin lists a psychedelic dosage as being 40-80 mg, with effects lasting 12-18 hours.

Pharmacology

The mechanism that produces the hallucinogenic and entheogenic effects of isoproscaline is most likely to result from action as a 5-HT_2A serotonin receptor agonist in the brain, a mechanism of action shared by all of the hallucinogenic tryptamines and phenethylamines.

Dangers

The toxicity of isoproscaline is not known.

Legality

Isoproscaline is unscheduled and unregulated in the United States, however because of its close similarity in structure and effects to mescaline, possession and sale of isoproscaline may be subject to prosecution under the Federal Analog Act.

ee also

*Proscaline
*PiHKAL

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal092.shtml Isoproscaline entry in PiHKAL]