RPL-554

drugbox
IUPAC_name = 9,10-Dimethoxy-2-(2,4,6-trimethylphenylimino)-3-(N-carbamoyl-2-aminoethyl)-3,4,6,7-tetrahydro-2H-pyrimido [6,1-a] isoquinolin-4-one

---

width = 240
CAS_number =
ATC_prefix =
ATC_suffix =
PubChem = 9934746
DrugBank =
C=26|H=31|N=5|O=4
molecular_weight = 477.554 g/mol
smiles = Cc3cc(C)cc(C)c3N=c2cc1-c(cc4OC)c(cc4OC)CCn1c(=O)n2CCNC(N)=O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

RPL-554 (LS-193,855) is a drug which acts as a long-acting inhibitor of the phosphodiesterase enzymes PDE-3 and PDE-4, producing both bronchodilator and antiinflammatory effects. [ [http://jpet.aspetjournals.org/cgi/reprint/318/2/840.pdf Boswell-Smith V, Spina D, Oxford AW, Comer MB, Seeds EA, Page CP. The Pharmacology of Two Novel Long-Acting Phosphodiesterase 3/4 Inhibitors, RPL554 (9,10-Dimethoxy-2-(2,4,6-trimethylphenylimino)-3-(N-carbamoyl-2-aminoethyl)-3,4,6,7-tetrahydro-2H-pyrimido(6,1-a)isoquinolin-4-one) and RPL565 (6,7-Dihydro-2-(2,6-diisopropylphenoxy)-9,10-dimethoxy-4H-pyrimido(6,1-a)isoquinolin-4-one). "Journal of Pharmacology and Experimental Therapeutics" 2006; 318(2):840-848.] ] It is being developed by Verona Pharma as a potential treatment for asthma and hayfever, and is currently in clinical trials. [ [http://www.veronapharma.com/s/LeadDrugRPL554.asp Verona Pharma Plc - Lead Drug RPL554] ] [ [http://news.bbc.co.uk/2/hi/health/7607665.stm Asthma and hay fever drug tested. BBC News, Wednesday 10 September 2008] ]

References