Lecozotan

Drugbox
IUPAC_name = 4-Cyano-N- [(2R)-2- [4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-piperazinyl] propyl] -N-2-pyridinylbenzamide hydrochloride

---

CAS_number =
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem =
DrugBank =
chemical_formula =
C=28 | H=30 | Cl=1 | N=5 | O=3
molecular_weight = 520.021 g/mol
smiles = c5ccc1OCCOc1c5N(CC4)CCN4C(C)CN(C(=O)c(cc2)ccc2C#N)c3ncccc3.Cl
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Lecozotan is an investigational drug by Wyeth tested for improvement of cognitive functions of Alzheimer's disease patients. [cite journal
author = H. Spreitzer
date = August 13, 2008
title = Neue Wirkstoffe - Lecozotan
journal = Österreichische Apothekerzeitung
issue = 17/2007
pages = 805
language = German ] as of|June 2008, the first Phase III clinical trial has been completed. [ [http://clinicaltrials.gov/ct2/results?intr=%22Lecozotan+SR%22 ClinicalTrials] ]

Method of action

Lecozotan is a competitive, selective serotonin 5-HT_1A receptor antagonist [cite journal|last=Schlechter|first=LE|date=June 10, 2005|title=Lecotozan (SRA-333): A selective serotonin1A receptor antagonist that enhances the stimulated release of glutamate and acetylcholine in the hippocampus and promotes procognitive effects|journal=Journal of Pharmacology And Experimental Therapeutics|url=http://jpet.aspetjournals.org/cgi/content/short/jpet.105.086363v1] which enhances the potassium-stimulated release of acetylcholine and glutamate. [cite journal
author = Childers, WE Jr, Harrison, BL, Abou-Gharbia, MA, Raje, S, Parks, V, Pangalos, MN, Schechter, LE
title = Lecozotan Hydrochloride
journal = Drugs of the Future
year = 2007
volume = 32
issue = 5
pages = 399-407
url = http://journals.prous.com/journals/servlet/xmlxsl/pk_journals.xml_summary_pr?p_JournalId=2&p_RefId=1092901&p_IsPs=N ]

References