Lurasidone

Drugbox
IUPAC_name = (3aR,4S,7R,7aS)-2- [(1R,2R)-2- [4-(1,2-Benzisothiazol-3-yl)-piperazin-1-ylmethyl] cyclohexylmethyl] hexahydro-1H-4,7-methanisoindol-1,3-dione

---

CAS_number =
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 213046
DrugBank =
chemical_formula =
C=28 | H=36 | N=4 | O=2 | S=1
molecular_weight = 492.676 g/mol
smiles = C1CCC(C(C1)CN2CCN(CC2)C3=NSC4=CC=CC=C43)CN5C(=O)C6C7CCC(C7)C6C5=O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration = oral

Lurasidone is a atypical antipsychotic by Dainippon Sumitomo Pharma (Japan). as of|2008, it is undergoing a Phase III clinical trial.

Lurasidone blocks D₂- and 5-HT_2A-receptors. It seems to cause less extrapyramidal side effects than current antipsychotics.

References

* cite journal
author = H. Spreitzer
date = June 9, 2008
title = Neue Wirkstoffe - Lurasidon
journal = Österreichische Apothekerzeitung
issue = 12/2008
pages = 616
language = German
* cite journal
author = Cole, P., Serradell, N., Rosa, E., Bolos, J.
title = Lurasidone hydrochloride. Dopamine D2/5-HT_2A antagonist, Treatment of schizophrenia.
journal = Drugs of the Future
year = 2008
volume = 33
issue = 4
pages = 316-322