- Landiolol
Drugbox
IUPAC_name = [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl] methyl 3- [4- [(2S)-2-hydroxy-3- [2-(morpholine-4-carbonylamino)ethylamino] propoxy] phenyl] propanoate
width = 300
CAS_number = 133242-30-5
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 114905
DrugBank =
chemical_formula =
C=25 | H=39 | N=3 | O=8
molecular_weight = 509.59 g/mol
smiles = CC1(OCC(O1)COC(=O)CCC2=CC=C(C=C2)OCC(CNCCNC(=O)N3CCOCC3)O)C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = IVLandiolol (INN) is a drug which acts as a highly cardioselective, ultra short-acting
beta blocker . It is used as an anti-arrhythmic agent.References
*cite journal |author=Yoshiya I |title= [Landiolol hydrochloride, a new sympathetic beta blocker] |language=Japanese |journal=Masui |volume=47 Suppl |issue= |pages=S126–32 |year=1998 |month=December |pmid=9921175 |doi= |url=
*cite journal |author=Ogata J, Okamoto T, Minami K |title=Landiolol for the treatment of tachyarrhythmia associated with atrial fibrillation |journal=Can J Anaesth |volume=50 |issue=7 |pages=753 |year=2003 |pmid=12944459 |doi= |url=
Wikimedia Foundation. 2010.