- Imidafenacin
Drugbox
IUPAC_name = 4-(2-methylimidazol-1-yl)-2,2-di(phenyl)butanamide
CAS_number = 170105-16-5
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 6433090
DrugBank =
chemical_formula =
C=20 | H=21 | N=3 | O=1
molecular_weight = 319.40 g/mol
smiles = CC1=NC=CN1CCC(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = OralImidafenacin (INN) is a a
urinary antispasmodic of theanticholinergic class.References
*cite journal |author=Kobayashi F, Yageta Y, Segawa M, Matsuzawa S |title=Effects of imidafenacin (KRP-197/ONO-8025), a new anti-cholinergic agent, on muscarinic acetylcholine receptors. High affinities for M3 and M1 receptor subtypes and selectivity for urinary bladder over salivary gland |journal=Arzneimittelforschung |volume=57 |issue=2 |pages=92–100 |year=2007 |pmid=17396619 |doi= |url=
*cite journal |author=Miyachi H, Kiyota H, Uchiki H, Segawa M |title=Synthesis and antimuscarinic activity of a series of 4-(1-Imidazolyl)-2,2-diphenylbutyramides: discovery of potent and subtype-selective antimuscarinic agents |journal=Bioorg. Med. Chem. |volume=7 |issue=6 |pages=1151–61 |year=1999 |month=June |pmid=10428387 |doi= |url=http://linkinghub.elsevier.com/retrieve/pii/S0968-0896(99)00003-6
Wikimedia Foundation. 2010.
