Binospirone

drugbox
IUPAC_name = 8- [2-(2,3-dihydro-1,4-benzodioxin-2-ylmethylamino)ethyl] -8-azaspiro [4.5] decane-7,9-dione

---

width = 220
CAS_number = 124756-23-6
synonyms = Binospirone
ATC_prefix =
ATC_suffix =
PubChem = 60769
DrugBank =
C = 20 | H = 26 | N = 2 | O = 4
molecular_weight = 358.431 g/mol
smiles = C1CCC2(C1)CC(=O)N(C(=O)C2)CCNCC3COC4=CC=CC=C4O3
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Binospirone (MDL-73005-EF) is a drug which acts as a partial agonist at 5HT_1A somatodendritic autoreceptors but as an antagonist at postsynaptic 5HT_1A receptors. [Bertrand F, Lehmann O, Galani R, Lazarus C, Jeltsch H, Cassel JC. Effects of MDL 73005 on water-maze performances and locomotor activity in scopolamine-treated rats. "Pharmacology, Biochemistry and Behaviour". 2001 Apr;68(4):647-60. PMID 11526961] It has anxiolytic effects. [Moser PC, Tricklebank MD, Middlemiss DN, Mir AK, Hibert MF, Fozard JR. Characterization of MDL 73005EF as a 5-HT1A selective ligand and its effects in animal models of anxiety: comparison with buspirone, 8-OH-DPAT and diazepam. "British Journal of Pharmacology". 1990 Feb;99(2):343-9. PMID 1970269]

References