Seratrodast

Drugbox
IUPAC_name = 7-Phenyl-7-(2,4,5-trimethyl-3,6-dioxo-1-cyclohexa-1,4-dienyl)heptanoic acid

---

CAS_number = 112665-43-7
CAS_supplemental =
ATC_prefix = R03
ATC_suffix = DX06
ATC_supplemental =
PubChem = 2449
DrugBank =
chemical_formula =
C=22 | H=26 | N=4
molecular_weight = 354.43 g/mol
smiles = CC1=C(C(=O)C(=C(C1=O)C)C(CCCCCC(=O)O)C2=CC=CC=C2)C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Seratrodast (INN) is a thromboxane receptor antagonist used primarily in the treatment of asthma.cite journal |author=Endo S, Akiyama K |title= [Thromboxane A2 receptor antagonist in asthma therapy] |language=Japanese |journal=Nippon Rinsho |volume=54 |issue=11 |pages=3045–8 |year=1996 |month=November |pmid=8950952 |doi= |url=] cite journal |author=Hada S, Hashizume M, Nishii S, Yoshioka F, Yasunaga K |title= [Study on the inhibitory effect of AA-2414 on platelet aggregation and its clinical effect in asthmatic patients] |language=Japanese |journal=Arerugi |volume=42 |issue=1 |pages=18–25 |year=1993 |month=January |pmid=8457165 |doi= |url=]

References