Imuracetam

Chembox new
ImageFile = Imuracetam.png ImageSize = 140px
IUPACName = 1,3-bis [(2-oxopyrrolidin-1-yl)methyl] urea
OtherNames =
Section1 = Chembox Identifiers
PubChem = 163319
CASNo =67542-41-0
ATCCode_prefix =
ATCCode_suffix =
SMILES= C1CC(=O)N(C1)CNC(=O)NCN2CCCC2=O
Section2 = Chembox Properties
Formula = | C=11 | H=18 | N=4 | O=3
MolarMass = 254.286 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section5 = Chembox Pharmacology
AdminRoutes =
Bioavail =
Metabolism =
HalfLife =
ProteinBound =
Excretion =
Legal_status =
Legal_US =
Legal_UK =
Legal_AU =
Legal_CA =
PregCat =
PregCat_AU =
PregCat_US =

Imuracetam is a nootropic drug of the racetam family. [Avetisyan SA, Kocharov SL, Azaryan LV, Dzhagatspanyan IA, Melikyan GG. Synthesis and psychotropic activity of new 2-pyrrolidone derivatives. "Pharmaceutical Chemistry Journal". 1998; 32(2):55-58.]

References