Bepotastine

Drugbox
IUPAC_name = 4- [4- [(4-chlorophenyl)-pyridin-2-ylmethoxy] piperidin-1-yl] butanoic acid

---

CAS_number = 125602-71-3
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 2350
DrugBank =
chemical_formula =
C=21 | H=25 | Cl=1 | N=2 | O=3
molecular_weight = 388.88 g/mol
smiles = C1CN(CCC1OC(C2=CC=C(C=C2)Cl)C3=CC=CC=N3)CCCC(=O)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Bepotastine (INN, sold under the brand name Talion) is an antihistamine.

Bepotastine was approved in Japan for use in the treatment of allergic rhinitis and uriticaria/puritus in July 2000 and January 2002, respectively, and is marketed by Tanabe Seiyaku Co., Ltd. under the brand name TALION. TALION was co-developed by Tanabe Seiyaku and Ube Industries, Ltd., who discovered bepotastine. In 2001, Tanabe Seiyaku granted Senju exclusive worldwide rights, with the exception of certain Asian countries, to develop, manufacture and market bepotastine for ophthalmic use.