- Tolrestat
Drugbox
IUPAC_name = 2-( [6-methoxy-5-(trifluoromethyl)naphthalene-1-carbothioyl] -methylamino)acetic acid
CAS_number = 82964-04-3
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 53359
DrugBank =
chemical_formula =
C=16 | H=14 | F=3 | N=1 | O=3 | S=1
molecular_weight = 357.34 g/mol
smiles = CN(CC(=O)O)C(=S)C1=CC=CC2=C1C=CC(=C2C(F)(F)F)OC
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Tolrestat (INN) (AY-27773) is an
aldose reductase inhibitor cite journal |author=Sestanj K, Bellini F, Fung S, "et al" |title=N- [5-(trifluoromethyl)-6-methoxy-1-naphthalenyl] thioxomethyl] - N-methylglycine (Tolrestat), a potent, orally active aldose reductase inhibitor |journal=J. Med. Chem. |volume=27 |issue=3 |pages=255–6 |year=1984 |month=March |pmid=6422042 |doi= |url=] which was approved for the control of certain diabetic complications.cite journal |author=Kador PF, Kinoshita JH, Sharpless NE |title=Aldose reductase inhibitors: a potential new class of agents for the pharmacological control of certain diabetic complications |journal=J. Med. Chem. |volume=28 |issue=7 |pages=841–9 |year=1985 |month=July |pmid=3925146 |doi= |url=]It was discontinued by
Wyeth in1997 because of the risk of severe liver toxicity and death. It was sold under the tradename Alredase.References
Wikimedia Foundation. 2010.