Amibegron

Drugbox
IUPAC_name = Ethyl ( [(7S)-7-( [(2R)-2-(3-chlorophenyl)-2-hydroxyethyl] amino)-5,6,7,8-tetrahydronaphthalen-2-yl] oxy)acetate

---

width = 240
CAS_number = 121524-09-2
ATC_prefix =
ATC_suffix =
PubChem = 3035442
DrugBank =
C=22|H=26|Cl=1|N=1|O=4
molecular_weight = 403.898 g/mol
smiles = CCOC(=O)COc3ccc1CCC(Cc1c3)NCC(O)c2cc(Cl)ccc2
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Amibegron (SR-58,611A) is a drug developed by Sanofi-Aventis which acts as a selective agonist for the β3 adrenergic receptor. It is the first orally active β3 agonist developed that is capable of entering the Central Nervous System, and has antidepressant and anxiolytic effects. [Stemmelin J, Cohen C, Terranova JP, Lopez-Grancha M, Pichat P, Bergis O, Decobert M, Santucci V, Françon D, Alonso R, Stahl SM, Keane P, Avenet P, Scatton B, le Fur G, Griebel G. Stimulation of the beta3-Adrenoceptor as a novel treatment strategy for anxiety and depressive disorders. "Neuropsychopharmacology". 2008 Feb;33(3):574-87. PMID 17460614] [Overstreet DH, Stemmelin J, Griebel G. Confirmation of antidepressant potential of the selective beta3 adrenoceptor agonist amibegron in an animal model of depression. "Pharmacology, Biochemistry and Behaviour". 2008 Jun;89(4):623-6. PMID 18358519]

References