- Flesinoxan
drugbox
IUPAC_name = 4-fluoro-N- [2- [4- [(3S)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-8-yl] piperazin-1-yl] ethyl] benzamide
width = 120
CAS_number = 98206-10-1
ATC_prefix =
ATC_suffix =
PubChem = 57347
DrugBank =
C=22|H=26|F=1|N=3|O=4
molecular_weight = 415.458 g/mol
smiles = C1CN(CCN1CCNC(=O)C2=CC=C(C=C2)F)C3=C4C(=CC=C3)O [C@H] (CO4)CO
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Flesinoxan (DU-29373) is an
anxiolytic drug which acts as a selective 5-HT1Aagonist . [Pitchot W, Wauthy J, Legros JJ, Ansseau M. Hormonal and temperature responses to flesinoxan in normal volunteers: an antagonist study. "European Neuropsychopharmacology". 2004 Mar;14(2):151-5. PMID 15013031]References
Wikimedia Foundation. 2010.