Tribromoisocyanuric acid

Chembox new
Name = Tribromoisocyanuric acid
ImageFile = Tribromoisocyanuric acid.png ImageSize = 150px
IUPACName = 1,3,5-Tribromo-1,3,5-
triazinane-2,4,6-trione
OtherNames = TBCA
1,3,5-tribromo-1,3,5-triazine
-2,4,6(1H,3H,5H)-trione

Section1 = Chembox Identifiers
SMILES = C1(=O)N(C(=O)N(C(=O)N1Br)Br)Br
CASOther = CAS|17497-85-7
RTECS =
Section2 = Chembox Properties
Formula = C₃Br₃N₃O₃
MolarMass = 366 g/mol
Appearance = colourless solid
Density =
Solubility =
Solvent = sulfuric acid
SolubleOther = Soluble
MeltingPt =
BoilingPt = decomp.
Section3 = Chembox Structure
Coordination = planar
CrystalStruct =
Dipole = 0 D
Section7 = Chembox Hazards
ExternalMSDS =
MainHazards = lung irritant
FlashPt = NA
RPhrases =
SPhrases =
Section8 = Chembox Related
OtherCpds = Cyanuric bromide
Dibromoisocyanuric acid
Trichloroisocyanuric acid

Tribromoisocyanuric acid (C₃Br₃N₃O₃) is a chemical compound used as a reagent for bromination in organic synthesis. [ A New Regioselective Bromination of Activated Aromatic Rings, Almeida, L. S. de; Esteves, P. M.; Mattos, M. C. S. Synthesis 2006, No 2 , 221-223. (http://www.thieme-connect.com/ejournals/pdf/synthesis/doi/10.1055/s-2005-918511.pdf) ] It is a white crystalline powder with a strong bromine odour. It is similar to trichloroisocyanuric acid.

Uses

Tribromoisocyanuric acid is used for the bromination of aromatics and alkenes.

References