Trichloroisocyanuric acid

Chembox new
Name = Trichloroisocyanuric acid
ImageFileL1 = Symclosene.svg
ImageSizeL1 = 120px
ImageFileR1 = Symclosene3d.png ImageSizeR1 = 140px
ImageNameR1 = Symclosene
IUPACName = 1,3,5-trichloro-1,3,5-
triazinane-2,4,6-trione
OtherNames = TCICA
1,3,5-trichloro-1,3,5-triazine
-2,4,6(1H,3H,5H)-trione

Section1 = Chembox Identifiers
SMILES = C1(=O)N(C(=O)N(C(=O)N1Cl)Cl)Cl
CASOther = CAS|87-90-1
RTECS = XZ1925000
Section2 = Chembox Properties
Formula = C₃Cl₃N₃O₃
MolarMass = 232.41 g/mol
Appearance = colourless solid
Density = 2.19 ± 0.1 g/cm³
Solubility = 0.2%
Solvent = other solvents
SolubleOther = chlorocarbons
acetone
acetonitrile
MeltingPt = 249-51 °C
BoilingPt = decomp.
Section3 = Chembox Structure
Coordination = planar
CrystalStruct =
Dipole = 0 D
Section7 = Chembox Hazards
ExternalMSDS =
MainHazards = lung irritant
FlashPt = NA
RPhrases = 8-22-31-36/37-50/53
SPhrases = 8-26-41-60-61
Section8 = Chembox Related
OtherCpds = Cyanuric chloride
dichloroisocyanuric acid
Tribromoisocyanuric acid

Trichloroisocyanuric acid (C₃Cl₃N₃O₃), also known as Symclosene, trichloro-s-triazinetrione, TCCA, TCICA, and trichlor, is a chemical compound used as an industrial disinfectant, bleaching agent and a reagent in organic synthesis. [ Hiegel, G. A. "Trichloroisocyanuric Acid" in Encyclopedia of Reagents for Organic Synthesis 2001, John Wiley & Sons: New York. DOI: 10.1002/047084289X.rt209] [ Barros, J. C. "Trichloroisocyanuric acid". Synlett 2005: 2115-2116. DOI: 10.1055/s-2005-872237 [http://www.thieme-connect.com/ejournals/html/synlett/doi/10.1055/s-2005-872237] ] This white crystalline powder, which has a strong "chlorine odour," is sometimes sold in tablet or granule form for domestic and industrial use.

Use in water treatment

The compound is a disinfectant, algicide and bactericide mainly for swimming pools and dyestuffs, and is also used as a bleaching agent in the textile industries.

Applications: It is widely used in civil sanitation, pools and spas, preventing and curing diseases in husbandry and fisheries, fruits and vegetables preservation, wastewater treatment, algaecide for recycling water of industry and air conditioning, anti shrink treatment for woolen, treating seeds, bleaching fabrics, and organic synthesis industry

Benefits of TCCA in Swimming Pool-
* Available with 90% chlorine concentration
* Due to high chlorine content, handling is easy for large pools.
* Reduces chlorine loss during day time. TCCA is stable it does not strip like any other halogen compounds.
* Reduces algae growth as compared to any other disinfectant. It forms a protective blanket on the surface thereby reflecting sunlight back. This prevents algae growth.
* Dissolves slowly in water, allowing for continuously metered dosing of available chlorine, especially when in tablet form.

ee also

* Dichloroisocyanuric acid (Dichlor)

References

External links

* [http://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+hsdb:@term+@rn+@rel+87-90-1 Symclosene data page]
* [http://msds.chem.ox.ac.uk/TR/trichloroisocyanuric_acid.html Safety data] for trichloroisocyanuric acid from Oxford University Chemistry Department.