Pirolazamide

Pirolazamide

drugbox
IUPAC_name = 4-(1,4-diazabicyclo [4.3.0] non-4-yl)-2,2-diphenyl-butanamide



width = 250px


width2 =
CAS_number = 39186-49-7
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 71442
DrugBank =
chemical_formula =
C=23 | H=29 | N=3 | Co= | I= | Br= | Cl= | F= | O=1 | P= | S= | Se= | Na= | charge=
molecular_weight = 363.502
smiles = C1CC2CN(CCN2C1)CCC(C3=CC=CC=C3)(C4=CC=CC=C4)C(=O)N
synonyms =
density =
melting_point =
melting_high =
melting_notes =
boiling_point =
boiling_notes =
solubility =
specific_rotation =
sec_combustion =
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
licence_EU =
licence_US =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
dependency_liability =
routes_of_administration =

Pirolazamide is an antidepressant used in medicine and is composed of C23H29N3O.


Wikimedia Foundation. 2010.

Игры ⚽ Поможем написать курсовую

Share the article and excerpts

Direct link
Do a right-click on the link above
and select “Copy Link”