- 2-Aminoethoxydiphenyl borate
Chembox new
ImageFile = 2-APB.png
ImageSize = 200px
IUPACName = 2-Diphenylboranyloxyethanamine
OtherNames = 2-Aminoethyl diphenyl borate
Abbreviations = 2-APB
Section1 = Chembox Identifiers
CASNo = 524-95-8
PubChem = 1598
SMILES = B(C1=CC=CC=C1)(C2=CC=CC=C2)OCCN
Section2 = Chembox Properties
C=14|H=16|B=1|N=1|O=1
MolarMass = 225.094 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =
SPhrases=S22 S24/252-Aminoethoxydiphenyl borate (2-APB) is a chemical that acts to inhibit both IP3 receptors [Diver JM, Sage SO, Rosado JA (2001). The inositol trisphosphate receptor antagonist 2-aminoethoxydiphenylborate (2-APB) blocks Ca2+ entry channels in human platelets: cautions for its use in studying Ca2+ influx. "Cell Calcium, 30"(5), 323-329.] and TRP channels (although it activates
TRPV1 ,TRPV2 , &TRPV3 at higher concentrations). [Xu SZ, Zeng F, Boulay G, Grimm C, Harteneck C, Beech DJ (2005). Block of TRPC5 channels by 2-aminoethoxydiphenyl borate: a differential, extracellular and voltage-dependent effect. "British Journal of Pharmacology, 145"(4), 320-328.] [Bootman, MD, Collins, TJ, Makenzie, L, Roderick, HL, Berridge, MJ, & Peppiatt, CM (2002). 2-Aminoethoxydiphenyl borate (2-APB) is a reliable blocker of store-operated Ca2+ entry but an inconsistent inhibitor of InsP3-induced Ca2+ release. "The FASEB Journal, 16"(10), 1145-1150.] In research it is used to manipulate intracellular release of calcium ions (Ca2+) and modify TRP channel activity, although there its lack of specific effects make it less than ideal under some circumstances. Additionally, there is evidence that 2-APB acts directly to inhibit gap junctions comprised of connexin26 or connexin32. [Tao, L, & Harris, AL (2007). 2-aminoethoxydiphenyl borate directly inhibits channels composed of connexin26 and/or connexin32. "Molecular Pharmacology, 71"(2), 570-579.]Also note that many manufacturers provide descriptions of known pharmacologic activity for their products (i.e. [http://www.tocris.com/dispprod.php?ItemId=1427 Tocris] or [http://www.sigmaaldrich.com/catalog/search/ProductDetail/SIGMA/D9754 Sigma-Aldrich] )
References
Wikimedia Foundation. 2010.