2C-T-9

Chembox new
ImageFile1 = 2C-T-9.png ImageSize1 = 180px
ImageFile2 = 2C-T-9-3d-sticks.png ImageSize2 = 200px
IUPACName = 2- [4-(Butylthio)-2,5-dimethoxyphenyl] ethanamine
OtherNames =
Section1 = Chembox Identifiers
CASNo = 207740-28-1
PubChem =
SMILES = C1(=CC(=C(C=C1CCN)OC)SCCCC)OC
Section2 = Chembox Properties
Formula = C₁₄H₂₃NO₂S
MolarMass = 269.40 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

2C-T-9 is a psychedelic phenethylamine of the 2C family. It was first synthesized by Alexander Shulgin, sometimes used as an entheogen.

Chemistry

2C-T-9 is 2,5-dimethoxy-4-(n)-butylthiophenethylamine.

The IUPAC name of 2C-T-9 is 1-(4-(n-butylthio)-2,5-dimethoxyphenyl)-2-aminoethane.

Dosage

In his book "PiHKAL (Phenethylamines i Have Known And Loved)", Shulgin lists the dosage range as 60 - 100 mg.

ubjective Qualities

It is generally taken orally, and effects typically last 12 to 18 hours. [CitePiHKAL] There have been no reported deaths from 2C-T-9. The drug is said to taste like motor oil, and experiences have focused primarily on energy as opposed to creativity or insight.

Pharmacology

The mechanism that produces 2C-T-9’s hallucinogenic and entheogenic effects has not been specifically established, however it is most likely to result from action as a 5-HT_2A serotonin receptor agonist in the brain, a mechanism of action shared by all of the hallucinogenic tryptamines and phenethylamines for which the mechanism of action is known.

Dangers

The toxicity of 2C-T-9 is not well documented. 2C-T-9 is considerably less potent than 2C-T-7, but it may be expected that at higher doses it would display similar toxicity to that of other phenethylamines of the 2C-T family. Other phenethylamine derivatives substituted with an alkylthio group at the 4 position such as 2C-T-7 and 4-MTA are known to act as selective monoamine oxidase A inhibitors, a side effect which can lead to lethal serotonin syndrome when they are combined with stimulant drugs. Most confirmed fatalities involving 2C-T drugs involve their combination with other hard drugs such as alcohol, ecstasy or cocaine.

Legality

2C-T-9 is not illegal, but possession and sales of 2C-T-9 could be prosecuted under the Federal Analog Act because of its structural similarities to 2C-T-7.

References

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal045.shtml 2C-T-9 Entry in PiHKAL]