MDBU

Chembox new
ImageFile = MDBU.png ImageSize =
IUPACName = "N"- [1-(1,3-benzodioxol-5-yl)propan-2-yl] butan-1-amine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1=C2C(=CC=C1CC(C)NCCCC)OCO2
Section2 = Chembox Properties
Formula = C₁₄H₁₉NO₂
MolarMass = 235.325 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MDBU, or 3,4-methylenedioxy-N-butylamphetamine, is a lesser-known psychedelic drug. It is also the N-butyl isomer of MDA. MDBU was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 40mg, and the duration unknown. MDBU produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDBU.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants
* MDA

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal102.shtml MDBU entry in "PiHKAL"]