- MDAL
Chembox new
ImageFile = MDAL.png
ImageSize =
IUPACName = "N"- [1-(1,3-benzodioxol-5-yl)propan-2-yl] prop-2-en-1-amine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1=C2C(=CC=C1CC(C)NCC=C)OCO2
Section2 = Chembox Properties
Formula = C13H17NO2
MolarMass = 219.283 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =MDAL, or 3,4-
methyl enedioxy -N-allyl amphetamine , is a lesser-known psychedelic drug. It is also the N-allyl isomer of MDA. MDAL was first synthesized byAlexander Shulgin . In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 180mg, and the duration unknown. MDAL produces few to no effects on its own, but may enhance the effects of LSD. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDAL.See also
*
Phenethylamine
*Psychedelics, dissociatives and deliriants
* MDA
*MDPR External links
* [http://www.erowid.org/library/books_online/pihkal/pihkal101.shtml MDAL entry in "PiHKAL"]
Wikimedia Foundation. 2010.