Escaline

Chembox new
ImageFile1 = Escaline.png ImageSize1 = 200px
ImageFile2 = Escaline-3d-sticks.png ImageSize2 = 200px
IUPACName = 2-(4-Ethoxy-3,5-dimethoxy-phenyl)-ethylamine
OtherNames = 3,5-Dimethoxy-4-ethoxy-phenethylamine
2-(4-Ethoxy-3,5-dimethoxyphenyl)ethanamine
Section1 = Chembox Identifiers
CASNo = 39201-82-6
PubChem =
SMILES = NCCC1=CC(OC)=C(OCC)C(OC)=C1
Section2 = Chembox Properties
Formula = C₁₂H₁₉NO₃
MolarMass = 225.28 g/mol
Appearance =
Density =
MeltingPt = 165-166 °C (hydrochloride)
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

Escaline is a psychedelic drug and entheogen of the phenethylamine class of compounds. Escaline was first synthesized and reported in the scientific literature by Benington, et al, in 1954, but was later re-examined in the laboratory of David E. Nichols, who prepared a series of mescaline analogues that included escaline, proscaline, and isoproscaline. The effects of this and related mescaline analogues in humans were first described by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", Shulgin lists the dosage range as 40 to 60 mg, consumed orally. The duration of action was stated to be 8 - 12 hours.

Escaline is the phenethylamine analog of 3C-E and the 4-ethoxy analog of mescaline.

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal072.shtml PiHKAL entry]