F-2 (psychedelic)

Drugbox
IUPAC_name =

---

width = 200
CAS_number =
ATC_prefix =
ATC_suffix =
PubChem =
smiles = C1=C2C(=CC(=C1CC(C)N)OC)CC(O2)C
DrugBank =
chemical_formula = |C=13 |H=19 |N=1 |O=2
molecular_weight = 221.299 gr/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

F-2, or 6-(2-aminopropyl)-5-methoxy-2-methyl-2,3-dihydrobenzofuran, is a lesser-known psychedelic drug. F-2 was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 15mg, and the duration unknown.CitePiHKAL] F-2 produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of F-2.

References

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal079.shtml F-2 Entry in "PiHKAL"]