- AEM (psychedelic)
Chembox new
ImageFile1 = AE-mescaline.png
ImageSize1 = 180px
ImageFile2 = AEM-3d-sticks.png
ImageSize2 = 200px
IUPACName = 1-(3,4,5-Trimethoxy-benzyl)-propylamine
OtherNames = Alpha-ethyl mescaline
3,4,5-Trimethoxy-alpha-ethylphenethylamine
3,4,5-Trimethoxy-1-ethyl-(alpha-ethyl)amine
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = COc1c(cc(cc1OC)CC(N)CC)OC
Section2 = Chembox Properties
Formula = C13H21NO3
MolarMass = 239.31 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =AEM, alpha-ethylmescaline, or 3,4,5-tri
methoxy -alpha-ethyl phenethylamine , is a lesser-known psychedelic drug. It is an analog ofmescaline . AEM was first synthesized byAlexander Shulgin . In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 220 mg, and the duration unknown. [CitePiHKAL] AEM produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of AEM.References
See also
*
Mescaline
*Phenethylamine
*Psychedelics, dissociatives and deliriants External links
* [http://www.erowid.org/library/books_online/pihkal/pihkal001.shtml AEM Entry in "PiHKAL"]
Wikimedia Foundation. 2010.