FLEA (psychedelic)

Drugbox
IUPAC_name = "N"-(2-Benzo [1,3] dioxol-5-yl-1-methyl-ethyl)-N-methyl-hydroxylamine

---

|width=200
CAS_number = 214414-88-7
ATC_prefix =
ATC_suffix =
PubChem =
smiles = C1=C2C(=CC=C1CC(C)N(C)O)OCO2
DrugBank =
chemical_formula = |C=11 |H=15 |N=1 |O=3
molecular_weight = 209.24
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

FLEA, or 3,4-methylenedioxy-alpha,N-dimethyl-N-hydroxyphenethylamine, is a lesser-known psychedelic drug and a substituted amphetamine. It is the N-hydroxy homolog of MDMA (Ecstasy). FLEA was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 100-160mg, and the duration listed as 4-8 hours. [CitePiHKAL] FLEA causes entactogenic, open MDMA-like effects and eases communication. It also increases appreciation of the senses. Very little data exists about the pharmacological properties, metabolism, and toxicity of FLEA.

References

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal081.shtml FLEA Entry in "PiHKAL"]