MDPH

Chembox new
ImageFile = MDPH.png ImageSize = 200px
IUPACName = 2-Benzo [1,3] dioxol-5-yl-1,1-dimethyl-ethylamine
OtherNames = 3,4-Methylenedioxyphentermine;
3,4-Methylenedioxy-alpha,alpha-dimethyl-1-ethane
Section1 = Chembox Identifiers
CASNo = 39235-63-7
PubChem =
SMILES = NC(C)(C)CC1=CC(OCO2)=C2C=C1
Section2 = Chembox Properties
Formula = C₁₁H₁₅NO₂
MolarMass = 193.24
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MDPH, or 3,4-methylenedioxyphentermine, is a lesser-known psychedelic drug. MDPH was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 160-240mg, and the duration as 3-5 hours. MDPH's effects are very similar to those of MDA: they both are smooth and "stoning," and do not cause any visuals. They also alter dreams and dream patterns. Shulgin describes MDPH as a promoter; it promotes the effects of other drugs, similarly to 2C-D. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDPH.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal116.shtml MDPH entry in "PiHKAL"]