Linoelaidic acid

Chembox new
Reference= [ [http://www.sigmaaldrich.com/catalog/search/ProductDetail/ALDRICH/W338001 Linoelaidic acid] at Sigma-Aldrich]
ImageFile = Linoelaidic acid.png ImageSize = 250px
Name = Linoelaidic acid
IUPACName = (9"E",12"E")-octadeca-9,12-dienoic acid
OtherNames = "trans, trans"-9,12-octadecadienoic acid
Section1 = Chembox Identifiers
CASNo = 506-21-8
PubChem = 5282457
SMILES = CCCCC/C=C/C/C=C/CCCCCCCC(=O)O
Section2 = Chembox Properties
Formula = C₁₈H₃₂O₂
MolarMass = 280.45 g/mol
Density =
MeltingPt = −5 °C
BoilingPt = 229-230 °C at 16 mmHg

Linoelaidic acid is an omega-6 trans fatty acid and is a geometric isomer of linoleic acid. It is found in partially hydrogenated vegetable oils.

References