- Ambucetamide
drugbox
IUPAC_name = 2-(dibutylamino)-2-(4-methoxyphenyl)acetamide
CAS_number = 519-88-0
ATC_prefix =
ATC_suffix =
PubChem = 10616
DrugBank =
chemical_formula =
C=17|H=28|N=2|O=2
molecular_weight = 292.417 g·mol−1
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
smiles = CCCCN(CCCC)C(C1=CC=C(C=C1)OC)C(=O)N
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Ambucetamide is an
antispasmodic found to be particularly effective for the relief ofmenstrual pain. It was discovered in 1953 byPaul Janssen .References
* Hoekstra JB, Fisher DS, Cull KM, Tisch DE, Dickison HL., Studies with a uterine antispasmodic, ambucetamide, J Am Pharm Assoc Am Pharm Assoc (Baltim). 1957 Sep;46(9):564-8.
* Pickles VR, Clitheroe HJ., The effects of ambucetamide on human myometrial and other preparations, and its antagonism to the menstrual stimulant, Br J Pharmacol Chemother. 1960 Mar;15:128-30.
Wikimedia Foundation. 2010.
