2C-C

Chembox new
ImageFile1 = 2C-C.png ImageSize1 = 180px
ImageFileL2 = 2C-C-3d-sticks.png ImageSizeL2 = 100px
ImageFileR2 = 2C-C animation.gif
ImageSizeR2 = 125px
IUPACName = 1-(4-Chloro-2,5-dimethoxyphenyl)-2-aminoethane
OtherNames = 4-Chloro-2,5-dimethoxy-phenethylamine
Section1 = Chembox Identifiers
CASNo = 88441-14-9
PubChem =
ChemSpiderID = 21106221
SMILES = NCCC1=C(OC)C=C(Cl)C(OC)=C1
Section2 = Chembox Properties
Formula = C₁₀H₁₄ClNO₂
MolarMass = 215.68 g/mol
Appearance =
Density =
MeltingPt = 220-221 °C (hydrochloride)
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

2C-C is a psychedelic drug of the 2C family. It was first synthesized by Alexander Shulgin, sometimes used as an entheogen. The full name of the chemical is 4-chloro-2,5-dimethoxyphenethylamine. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", Shulgin lists the dosage range as 20 to 40 mg. 2C-C is usually taken orally, but may also be insufflated [CitePiHKAL] . 2C-C is unscheduled and uncontrolled in the United States, but possession and sales of 2C-C could potentially be prosecuted under the Federal Analog Act because of 2C-C's close structural similarity to 2C-B.

Not much information is known about the toxicity of 2C-C. Many users report that 2C-C is gentler and more sedating than other closely related psychedelic phenethylamines.Fact|date=August 2008

Effects

* The visual effects of 2C-C are similar to those of LSD or psilocybin mushrooms, though much less intense. Unique among the psychedelics, 2C-C is intensely relaxing, almost sedating. Nasal insufflation (painful) or rectal administration bypasses first pass metabolism, requiring about half the dose normally used orally; the effects occur within 2-30 minutes via these routes and tend to last about an hour less. There are very few negative side effects attributed to 2C-C and nearly no hangover period.
* The effects can take up to two hours to manifest.
* Over the approximate dose range 20-40 mg, effects last respectively, approximately, 4 to 8 hours. Increased dosages increase the duration of the trip [CitePiHKAL] .

References

ee also

* Phenethylamines
* Tryptamines

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal022.shtml 2C-C Entry in PiHKAL]
* [http://www.erowid.org/chemicals/2cc/2cc.shtml Erowid 2C-C Vault]