Trichostatin A

drugbox
IUPAC_name = 7- [4-(dimethylamino)phenyl] -"N"-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide

---

---

CAS_number = 58880-19-6
ATC_prefix =
ATC_suffix =
PubChem = 444732
C=17 | H=22 | N=2 | O=2
smiles = CC(C=C(C)C=CC(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C
molecular_weight = 302.37 g/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_category = D—teratogenic
legal_status =
routes_of_administration =

Trichostatin A is an organic compound that serves as an antifungal antibiotic and selectively inhibits the class I and II mammalian histone deacetylase (HDAC) families of enzymes, but not class III HDACs (i.e., Sirtuins)cite journal | author = Vanhaecke T, Papeleu P, Elaut G, Rogiers V | title = Trichostatin A-like hydroxamate histone deacetylase inhibitors as therapeutic agents: toxicological point of view | journal = Curr Med Chem | volume = 11 | issue = 12 | pages = 1629-43 | year = 2004 | pmid = 15180568| doi = | url = | issn = ] . TSA inhibits the eukaryotic cell cycle during the beginning of the growth stage. TSA can be used to alter gene expression by interfering with the removal of acetyl groups from histones (histone deacetylases, HDAC) and therefore altering the ability of DNA transcription factors to access the DNA molecules inside chromatin. It is a member of a larger class of histone deacetylase inhibitors (HDIs or HDACIs) that have a broad spectrum of epigenetic activities. Thus, TSA has some uses as an anti-cancer drugcite journal | author = Drummond DC, Noble CO, Kirpotin DB, Guo Z, Scott GK, Benz CC | title = Clinical development of histone deacetylase inhibitors as anticancer agents | journal = Annu Rev Pharmacol Toxicol | volume = 45 | issue = | pages = 495-528 | year = 2005 | pmid = 15822187 | doi = ] . One suggested mechanism is that TSA promotes the expression of apoptosis-related genes, leading to cancerous cells surviving at lower rates, thus slowing the progression of cancercite journal | author = Shankar S, Srivastava RK | title = Histone deacetylase inhibitors: mechanisms and clinical significance in cancer: HDAC inhibitor-induced apoptosis | journal = Adv Exp Med Biol | volume = 615 | issue = | pages = 261-98 | year = 2008 | pmid = 18437899 | doi = | url = | issn = ] . Other mechanisms may include the activity of HDIs to induce cell differentiation, thus acting to "mature" some of the de-differentiated cells found in tumors. HDIs have multiple effects on non-histone effector molecules, so the anti-cancer mechanisms are truly not understood at this time.

ee also

*Histone deacetylase inhibitor
*Vorinostat (SAHA)

References

External links

* [http://www.fermentek.co.il/MSDS/trichostatin_A-MSDS.htm Trichostatin_A Safety data sheet] by Fermentek