5-MeO-DPT

drugbox
IUPAC_name = N- [2-(5-methoxy-1H-indol-3-yl)ethyl] -N-propylpropan-1-amine

---

width = 160
CAS_number = 2427-80-7
ATC_prefix =
ATC_suffix =
PubChem =
C=17 | H=26 | N=2 | O=1
molecular_weight = 274.40 g/mol
smiles = CCCN(CCC)CCC2=CNc1ccc(cc12)OC
melting_point = 193
melting_high = 194
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category =
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

5-MeO-DPT (also known as 5-methoxy-N,N-Dipropyltryptamine), is a hallucinogenic and entheogenic drug.

Chemistry

The full chemical name is N- [2-(5-methoxy-1H-indol-3-yl)ethyl] -N-propylpropan-1-amine. It is classified as a tryptamine derivative.

Effects

Little is known about the subjective effects of 5-MeO-DPT, but the nature of the compound probably comparable to psilocybin/psilocin, or DPT, which are also psychedelic tryptamines/indoles. However, the duration of the above mentioned drugs vary considerably.

Dosage

5-MeO-DPT is ly active, with 6-10 mg represents a fully effective dosage for most users. Effects begin within an hour, and usually last 4-6 hours.

External links

* [http://www.erowid.org/library/books_online/tihkal/tihkal36.shtml 5-MeO-DET TiHKAL Entry on Erowid, mentioning 5-MeO-DPT]