- ABTS
Chembox new
ImageFile = ABTS.png
ImageSize =
IUPACName = 2,2'-azino-bis(3-ethylbenzthiazoline-6-sulphonic acid)
OtherNames =
Section1 = Chembox Identifiers
CASNo = 28752-68-3
PubChem =
SMILES = CCN1/C(Sc2cc(ccc12)S(O)(=O)=O)=N/N=C/3Sc4cc(ccc4N3CC)S(O)(=O)=O
Section2 = Chembox Properties
Formula = C18H18N4O6S4
MolarMass = 514.62 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =
RPhrases = R36 R37 R38
SPhrases = S26-S36 Inbiochemistry , 2,2'-azino-bis(3-ethylbenzthiazoline-6-sulphonic acid) or ABTS is chemical compound used to observe the reaction kinetics of specificenzyme s. A common use for it is in theenzyme-linked immunosorbent assay (ELISA ) to detect for binding of molecules to each other.It is commonly used as a substrate with
hydrogen peroxide for aperoxidase enzyme or alone with alaccase enzyme. Its use allows the reaction kinetics ofperoxidases themselves to be followed. In this way it also can be used to indirectly follow the reaction kinetics of anyhydrogen peroxide producing enzyme, or to simply quantify the amount of hydrogen peroxide in a sample.ABTS + H_2O_2 overrightarrow{_{HRP ABTS^+ + H_2O
This compound is chosen because the enzyme facilitates the reaction with hydrogen peroxide, turning it into a green and soluble end-product. Its new
absorbance maximum of 405 nmlight can easily be followed with aspectrophotometer , a common laboratory instrument. It is sometimes used as part of aglucose estimatingreagent when finding glucose concentrations of solutions such asblood serum .
Wikimedia Foundation. 2010.