ABTS

Chembox new
ImageFile = ABTS.png ImageSize =
IUPACName = 2,2'-azino-bis(3-ethylbenzthiazoline-6-sulphonic acid)
OtherNames =
Section1 = Chembox Identifiers
CASNo = 28752-68-3
PubChem =
SMILES = CCN1/C(Sc2cc(ccc12)S(O)(=O)=O)=N/N=C/3Sc4cc(ccc4N3CC)S(O)(=O)=O
Section2 = Chembox Properties
Formula = C₁₈H₁₈N₄O₆S₄
MolarMass = 514.62 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =
RPhrases = R36 R37 R38
SPhrases = S26-S36 In biochemistry, 2,2'-azino-bis(3-ethylbenzthiazoline-6-sulphonic acid) or ABTS is chemical compound used to observe the reaction kinetics of specific enzymes. A common use for it is in the enzyme-linked immunosorbent assay (ELISA) to detect for binding of molecules to each other.

It is commonly used as a substrate with hydrogen peroxide for a peroxidase enzyme or alone with a laccase enzyme. Its use allows the reaction kinetics of peroxidases themselves to be followed. In this way it also can be used to indirectly follow the reaction kinetics of any hydrogen peroxide producing enzyme, or to simply quantify the amount of hydrogen peroxide in a sample.

$ABTS\; +\; H\_2O\_2\; overrightarrow\{\_\{HRP\; ABTS^+\; +\; H\_2O$

This compound is chosen because the enzyme facilitates the reaction with hydrogen peroxide, turning it into a green and soluble end-product. Its new absorbance maximum of 405 nm light can easily be followed with a spectrophotometer, a common laboratory instrument. It is sometimes used as part of a glucose estimating reagent when finding glucose concentrations of solutions such as blood serum.