Indole-3-butyric acid

Chembox new
Name = Indole-3-butyric acid
ImageFile=Indole-3-butyric acid structure.svg
IUPACName = 1H-Indole-3-butanoic acid
OtherNames = indole-3-butyric acid
3-indolebutyric acid
indolebutyric acid
IBA
Section1 = Chembox Identifiers
SMILES = OC(CCCC2=CNC1=CC=CC=C12)=O
CASNo = 133-32-4
RTECS = NL5250000
Section2 = Chembox Properties
Formula = C₁₂H₁₃NO₂
MolarMass = 203.24 g/mol
Appearance = white to light yellow crystals
Density =
Solubility =
MeltingPt = 125 °C
BoilingPt = decomposes
pKa =
pKb =
Viscosity =
Section3 = Chembox Structure
CrystalStruct = cubic
Dipole =
Section7 = Chembox Hazards
ExternalMSDS = [http://physchem.ox.ac.uk/MSDS/IN/indole-3-butyric_acid.html Oxford MSDS]
MainHazards =
FlashPt =
RPhrases = R25 R36/37/38
SPhrases = S26 S28 S36/37/39 S38 S45
Section8 = Chembox Related
Function =
OtherFunctn = auxin
indole-3-acetic acid

Indole-3-butyric acid (1H-Indole-3-butanoic acid, IBA) is a white to light-yellow crystalline solid, with the molecular formula C₁₂H₁₃NO₂. It melts at 125 °C in atmospheric pressure and decomposes before boiling.

As a Plant Hormone

IBA is a plant hormone in the auxin family and is an ingredient in many commercial plant rooting horticultural products.

For use as such, it should be dissolved in about 75% (or purer) alcohol (as IBA does not dissolve in water), until a concentration from between 10,000 ppm to 50,000 ppm is achieved - this solution should then be diluted to the required concentration using distilled water. The solution should be kept in a cool, dark place for best results.

This compound had been thought to be strictly synthetic; however, it was reported that the compound was isolated from leaves and seeds of maize and other species. [William. G.Hopkins(1999). "Introduction to Plant Physiology." John Wiley and Sons. ISBN 0-471-19281-3]

References

External links

* [http://www.super-grow.biz/IndoleButiricAcidPlantRootingHormone.jsp Super-Grow website]