BIBW 2992

Drugbox
IUPAC_name = N- [4- [(3-Chloro-4-flourophenyl)amino] -7- [(3S)-tetrahydro-3-furanyl] oxy] -6-quinazolinyl] -4(dimethylamino)-2-butenamide

---

CAS_number =
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem =
DrugBank =
chemical_formula =
C=24 | H=25 | Cl=1 | F=1 | N=5 | O=3
molecular_weight = 485.937 g/mol
smiles = CN(C)CC=CC(=O)Nc3cc1c(Nc(cc2Cl)ccc2F)ncnc1cc3OC4COCC4
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

BIBW 2992 (trade name Tovok) is a candidate drug against non-small cell lung carcinoma, developed by Boehringer Ingelheim. as of|2008|May, it is undergoing a Phase II clinical trial.

Method of action

BIBW 2992 is a dual kinase inhibitor, meaning it inhibits two receptors for growth factors (EGFR and HER2/neu). Consequently, it is directed against multi-resistant carcinomas with EGFR and HER2 mutations. These occur mainly in women, Eastern Asians and non-smokers.

References

* cite journal
author = H. Spreitzer
date = May 13, 2008
title = Neue Wirkstoffe - Tovok
journal = Österreichische Apothekerzeitung
issue = 10/2008
pages = 498
language = German