Ibodutant

Drugbox
IUPAC_name = 6-​methyl-​N-​ [1-​ [(2R)-​1-​ [1-​(oxan-​4-​ylmethyl)piperidin-​4-​ yl] methylamino] -​1-​oxo-​3-​phenylpropan-​2-​yl] carbamoyl] cyclopentyl] -​ 1-​benzothiophene-​2-​carboxamide

---

width = 150px
CAS_number =
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 11527495
DrugBank =
chemical_formula =
C=37 | H=48 | N=4 | O=4 | S=1
molecular_weight = 644.866 g/mol
smiles = CC1=CC2=C(C=C1)C=C(S2)C(=O)NC3(CCCC3)C(=O)NC(CC4=CC=CC=C4)C(=O)NCC5CCN(CC5)CC6CCOCC6
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration = oral

Ibodutant is a candidate drug against irritable bowel syndrome, developed by The Menarini Group. as of|2008|May, it is undergoing a multicentre double blind dose finding study.

Method of action

Ibodutant selectively blocks the tachykinin receptor NK₂. Blockage is practically complete in nanomolar concentrations.

References

* cite journal
author = H. Spreitzer
date = May 26, 2008
title = Neue Wirkstoffe - Ibodutant
journal = Österreichische Apothekerzeitung
issue = 11/2008
pages = 541
language = German
* cite journal
author = S. Giuliani, M. Altamura, C. A. Maggi
title = Ibodutant. Tachykinin NK₂ receptor antagonist, Treatment of irritable bowel syndrome.
journal = Drugs of the Future
volume = 33
issue = 2
pages = 111-115