Enviomycin

Drugbox
IUPAC_name = 3,6-diamino-"N"- [(3"R",6"Z")-3-(2-amino-3,4,5,6-tetrahydropyrimidin-4-yl)-6- [(carbamoylamino)methylidene] -9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclohexadec-15-yl] -4-hydroxyhexanamide

---

CAS_number = 33103-22-9
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 3032903
DrugBank =
chemical_formula =
C=25 | H=43 | N=13 | O=10
molecular_weight = 685.69 g/mol
smiles = C1CN=C(NC1C2C(=O)NCC(C(=O)NC(C(=O)NC(C(=O)NC(=CNC(=O)N)C(=O)N2)CO)CO)NC(=O)CC(C(CCN)O)N)N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = IM

Enviomycin (INN, also called tuberactinomycin N) is an antibiotic drug, isolated from "Streptomyces griseoverticillatus" var. "tuberacticus". [ [http://www.google.com/patents?id=FWMvAAAAEBAJ&dq=3892732 Jinnosuke Abe et al. Antibiotic Tuberactinomycin-N and process for production thereof. US patent 3892732] ] It is used in the treatment of tuberculosis. [Selvakumar N, Kumar V, Acharyulu GS, Rehman F, Paramasivan CN, Prabhakar R. Susceptibility of south Indian strains of Mycobacterium tuberculosis to tuberactinomycin. "Indian Journal of Medical Research". 1992 May;95:101-4. PMID 1506058]

References