- EA-3167
drugbox
IUPAC_name = 1-azabicyclo [2.2.2] octan-8-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate
width = 240
CAS_number = 26758-53-2
ATC_prefix =
ATC_suffix =
PubChem = 33597
DrugBank =
C=20|H=29|N=1|O=3
molecular_weight = 329.433 g/mol
smiles = C1CCC(C1)C(C2=CC=CC=C2)(C(=O)OC3CN4CCC3CC4)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =EA-3167 is a potent and long lasting
anticholinergic deliriant drug, related to the chemical warfare agent3-Quinuclidinyl benzilate (QNB). It was developed under contract to Edgewood Arsenal during the 1960s as part of the US military chemical weapons program, in an attempt to develop non-lethal incapacitating agents. EA-3167 has identical effects to QNB, but is even more potent and longer lasting, with an effective dose when administered by injection of as little as 2.5μg/kg (i.e. 0.2 milligrams for an 80kg person), and strong effects lasting for around 96 hours, with milder residual effects persisting for up to 10 days. [ [http://www.nap.edu/openbook.php?record_id=740&page=195 Possible Long-Term Health Effects of Short-Term Exposure to Chemical Agents, Volume 1 (1982). Commission on Life Sciences. The National Academies Press. pp195-196.] ] However unlike QNB, EA-3167 was never weaponized or manufactured in bulk.ee also
*
N-methyl-3-piperidyl benzilate
*N-ethyl-3-piperidyl benzilate
*3-Quinuclidinyl benzilate
*Ditran References
Wikimedia Foundation. 2010.