- Bosseopentaenoic acid
Chembox new
ImageFile = Bosseopentaenoic acid.png
ImageSize =
IUPACName = (5"Z",8"Z",10"E",12"E",14"Z")-Eicosapentaenoic acid
OtherNames =
Section1 = Chembox Identifiers
CASNo = 133205-91-1
PubChem =
SMILES = O=C(O)CCCCCCC/C=C/C=C/C=CCCCC
Section2 = Chembox Properties
Formula = C18H30O2
MolarMass = 278.43 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =Bosseopentaenoic acid is a conjugated polyunsaturated fatty acid. Bosseopentaenoic acid can extract from the red coralline algae, "Bossiella orbigniana". [cite journal| author=Burgess, J.R., De la Rosa, R.I., Jacobs, R.S., Butler, A|title= A new eicosapentaenoic acid formed from arachidonic acid in the coralline red algae Bossiella orbigniana|journal = Lipids |volume = 26 |issue=2 |pages=162-165]
References
Wikimedia Foundation. 2010.