Jacaric acid

Chembox new
ImageFile = Jacaric acid.png ImageSize =
IUPACName = (8"Z",10"E",12"Z")-Octadeca-8,10,12-trienoic acid
OtherNames = Jarcaric acid
Section1 = Chembox Identifiers
CASNo = 28872-28-8
PubChem =
SMILES = O=C(O)CCCCCC/C=CC=CC=C/CCCCC
Section2 = Chembox Properties
Formula = C₁₈H₃₀O₂
MolarMass = 302.45 g/mol
Appearance = 278.43
Density =
MeltingPtC = 44
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

Jacaric acid is a conjugated polyunsaturated fatty acid. The melting point of this fatty acid is °44 C. Jacaric acid occurs naturally in the seeds of the "Jacaranda mimosifolia". Jacaranda mimosifolia seeds are contain about 36% jacaric acid. [Gunstone, F.D et al. (2007). The Lipid Handbook with CD-ROM, Boca Raton: CRC Press. ISBN 0-8493-9688-3]

References