- C-8813
drugbox
IUPAC_name = "trans"-4-(p-Bromophenyl)-4-(dimethylamino)-1-(2-(thiophen-2-yl)ethyl)cyclohexanol
width = 200
CAS_number =
synonyms =
ATC_prefix =
ATC_suffix =
PubChem = 11058633
DrugBank =
C = 20 | H = 26 | Br = 1 | N = 1 | O = 1 | S = 1
molecular_weight = 408.394 g/mol
smiles = c1cc(Br)ccc1C3(N(C)C)CCC(O)(CC3)CCc2sccc2
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Legal
routes_of_administration =C-8813 is a potent μ-opioid agonist with a distinctive chemical structure which is not closely related to other established families of opioid drugs. It was found to be around 591x more potent than
morphine in animal studies. [Liu ZH, Jin WQ, Dai QY, Chen XJ, Zhang HP, Chi ZQ. Opioid activity of C8813, a novel and potent opioid analgesic. "Life Sciences". 2003 May 30;73(2):233-41. PMID 12738037]C-8813 has never been used in humans, but would be expected to produce effects similar to those of other potent opioid agonists, including strong
analgesia ,sedation , euphoria,constipation ,itching andrespiratory depression which could be harmful or fatal.ee Also
*
4-(p-Bromophenyl)-4-(dimethylamino)-1-phenethylcyclohexanol References
Wikimedia Foundation. 2010.
